C7H3F10N2+ — CID 87098440
1-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(trifluoromethyl)imidazol-3-ium (PubChem CID 87098440) has the molecular formula C7H3F10N2+ and a molecular weight of 305.10 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(trifluoromethyl)imidazol-3-ium.
| Compound Name | 1-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(trifluoromethyl)imidazol-3-ium |
|---|---|
| PubChem CID | 87098440 |
| Molecular Formula | C7H3F10N2+ |
| Molecular Weight | 305.10 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 1-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(trifluoromethyl)imidazol-3-ium |
| SMILES | FC(F)(F)[n+]1ccn(C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C7H3F10N2/c8-4(9,5(10,11)12)6(13,14)18-1-2-19(3-18)7(15,16)17/h1-3H/q+1 |
| InChIKey | WELSIXXUFJSWDK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.10 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|