C8H8F7N2+ — CID 102032954
1-(2,2,3,3,4,4,4-heptafluorobutyl)-3-methylimidazol-3-ium (PubChem CID 102032954) has the molecular formula C8H8F7N2+ and a molecular weight of 265.15 g/mol. Its IUPAC name is 1-(2,2,3,3,4,4,4-heptafluorobutyl)-3-methylimidazol-3-ium.
| Compound Name | 1-(2,2,3,3,4,4,4-heptafluorobutyl)-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 102032954 |
| Molecular Formula | C8H8F7N2+ |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 1-(2,2,3,3,4,4,4-heptafluorobutyl)-3-methylimidazol-3-ium |
| SMILES | C[n+]1ccn(CC(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C8H8F7N2/c1-16-2-3-17(5-16)4-6(9,10)7(11,12)8(13,14)15/h2-3,5H,4H2,1H3/q+1 |
| InChIKey | HSJHCGQDPXOFIZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|