C28H43F18N2P — CID 46191761
1-Methyl-3-octadecylimidazolium tris(pentafluoroethyl)trifluorophosphate (PubChem CID 46191761) has the molecular formula C28H43F18N2P and a molecular weight of 780.60 g/mol.
| Compound Name | 1-Methyl-3-octadecylimidazolium tris(pentafluoroethyl)trifluorophosphate |
|---|---|
| PubChem CID | 46191761 |
| Molecular Formula | C28H43F18N2P |
| Molecular Weight | 780.60 g/mol |
| Exact Mass | 780.29 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCCCCCCCCCn1cc[n+](C)c1.FC(F)(F)C(F)(F)[P-](F)(F)(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H43N2.C6F18P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-21-20-23(2)22-24;7-1(8,9)4(16,17)25(22,23,24,5(18,19)2(10,11)12)6(20,21)3(13,14)15/h20-22H,3-19H2,1-2H3;/q+1;-1 |
| InChIKey | MWCBXOFCMFFOQR-UHFFFAOYSA-N |
| XLogP | 13.77 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.60 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|