About 1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate
1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate (PubChem CID 11269922) has the molecular formula C14H27BF4N2Rh
and a molecular weight of 413.09 g/mol. Its IUPAC name is 1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate.
Molecular Properties
| Compound Name | 1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate |
| PubChem CID | 11269922 |
| Molecular Formula | C14H27BF4N2Rh |
| Molecular Weight | 413.09 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate |
| SMILES | CCCCCCCCCCn1cc[n+](C)c1.F[B-](F)(F)F.[Rh] |
| InChI | InChI=1S/C14H27N2.BF4.Rh/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;2-1(3,4)5;/h12-14H,3-11H2,1-2H3;;/q+1;-1; |
| InChIKey | RVVLUYKJIRBOLQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.09 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate?
The IUPAC name of 1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate (CID 11269922) is 1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate.
What is the SMILES notation for 1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate?
The canonical SMILES for 1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate is CCCCCCCCCCn1cc[n+](C)c1.F[B-](F)(F)F.[Rh].
What is the InChIKey of 1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate?
The InChIKey is RVVLUYKJIRBOLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N2.BF4.Rh/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;2-1(3,4)5;/h12-14H,3-11H2,1-2H3;;/q+1;-1;.
What are the key properties of 1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate?
1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate has a molecular weight of 413.09 g/mol, XLogP of 4.75, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decyl-3-methylimidazol-3-ium;rhodium;tetrafluoroborate is sourced from PubChem (CID 11269922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).