C9H12F5N2+ — CID 87213258
1-methyl-3-(4,4,5,5,5-pentafluoropentyl)imidazol-1-ium (PubChem CID 87213258) has the molecular formula C9H12F5N2+ and a molecular weight of 243.20 g/mol. Its IUPAC name is 1-methyl-3-(4,4,5,5,5-pentafluoropentyl)imidazol-1-ium.
| Compound Name | 1-methyl-3-(4,4,5,5,5-pentafluoropentyl)imidazol-1-ium |
|---|---|
| PubChem CID | 87213258 |
| Molecular Formula | C9H12F5N2+ |
| Molecular Weight | 243.20 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1-methyl-3-(4,4,5,5,5-pentafluoropentyl)imidazol-1-ium |
| SMILES | C[n+]1ccn(CCCC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H12F5N2/c1-15-5-6-16(7-15)4-2-3-8(10,11)9(12,13)14/h5-7H,2-4H2,1H3/q+1 |
| InChIKey | VFYBXYDYTSMBJL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|