C7H12BrF6N2P — CID 11187159
1-(3-bromopropyl)-3-methylimidazol-3-ium hexafluorophosphate (PubChem CID 11187159) has the molecular formula C7H12BrF6N2P and a molecular weight of 349.05 g/mol. Its IUPAC name is 1-(3-bromopropyl)-3-methylimidazol-3-ium hexafluorophosphate.
| Compound Name | 1-(3-bromopropyl)-3-methylimidazol-3-ium hexafluorophosphate |
|---|---|
| PubChem CID | 11187159 |
| Molecular Formula | C7H12BrF6N2P |
| Molecular Weight | 349.05 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 1-(3-bromopropyl)-3-methylimidazol-3-ium hexafluorophosphate |
| SMILES | C[n+]1ccn(CCCBr)c1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C7H12BrN2.F6P/c1-9-5-6-10(7-9)4-2-3-8;1-7(2,3,4,5)6/h5-7H,2-4H2,1H3;/q+1;-1 |
| InChIKey | XHNZJXYJIVAARK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.05 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|