C10H20F6N3P — CID 56954175
N,N-diethyl-2-(3-methylimidazol-3-ium-1-yl)ethanamine hexafluorophosphate (PubChem CID 56954175) has the molecular formula C10H20F6N3P and a molecular weight of 327.25 g/mol. Its IUPAC name is N,N-diethyl-2-(3-methylimidazol-3-ium-1-yl)ethanamine hexafluorophosphate.
| Compound Name | N,N-diethyl-2-(3-methylimidazol-3-ium-1-yl)ethanamine hexafluorophosphate |
|---|---|
| PubChem CID | 56954175 |
| Molecular Formula | C10H20F6N3P |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N,N-diethyl-2-(3-methylimidazol-3-ium-1-yl)ethanamine hexafluorophosphate |
| SMILES | CCN(CC)CCn1cc[n+](C)c1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C10H20N3.F6P/c1-4-12(5-2)8-9-13-7-6-11(3)10-13;1-7(2,3,4,5)6/h6-7,10H,4-5,8-9H2,1-3H3;/q+1;-1 |
| InChIKey | BOHLLYHEHBFXND-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|