C10H20BF4N3 — CID 155683102
N,N-diethyl-2-(3-methylimidazol-3-ium-1-yl)ethanamine tetrafluoroborate (PubChem CID 155683102) has the molecular formula C10H20BF4N3 and a molecular weight of 269.09 g/mol. Its IUPAC name is N,N-diethyl-2-(3-methylimidazol-3-ium-1-yl)ethanamine tetrafluoroborate.
| Compound Name | N,N-diethyl-2-(3-methylimidazol-3-ium-1-yl)ethanamine tetrafluoroborate |
|---|---|
| PubChem CID | 155683102 |
| Molecular Formula | C10H20BF4N3 |
| Molecular Weight | 269.09 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | N,N-diethyl-2-(3-methylimidazol-3-ium-1-yl)ethanamine tetrafluoroborate |
| SMILES | CCN(CC)CCn1cc[n+](C)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C10H20N3.BF4/c1-4-12(5-2)8-9-13-7-6-11(3)10-13;2-1(3,4)5/h6-7,10H,4-5,8-9H2,1-3H3;/q+1;-1 |
| InChIKey | MLXZNHPRZNQFSI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.09 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|