C10H16N3O4+ — CID 102151988
2-[carboxymethyl-[2-(3-methylimidazol-3-ium-1-yl)ethyl]amino]acetic acid (PubChem CID 102151988) has the molecular formula C10H16N3O4+ and a molecular weight of 242.25 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-(3-methylimidazol-3-ium-1-yl)ethyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-(3-methylimidazol-3-ium-1-yl)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 102151988 |
| Molecular Formula | C10H16N3O4+ |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-[carboxymethyl-[2-(3-methylimidazol-3-ium-1-yl)ethyl]amino]acetic acid |
| SMILES | C[n+]1ccn(CCN(CC(=O)O)CC(=O)O)c1 |
| InChI | InChI=1S/C10H15N3O4/c1-11-2-3-12(8-11)4-5-13(6-9(14)15)7-10(16)17/h2-3,8H,4-7H2,1H3,(H-,14,15,16,17)/p+1 |
| InChIKey | DRSNSLVCSLCGGM-UHFFFAOYSA-O |
| XLogP | -1.22 |
| TPSA | 86.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|