C18H30N7+3 — CID 88562344
2-(3-methylimidazol-3-ium-1-yl)-N,N-bis[2-(3-methylimidazol-3-ium-1-yl)ethyl]ethanamine (PubChem CID 88562344) has the molecular formula C18H30N7+3 and a molecular weight of 344.49 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)-N,N-bis[2-(3-methylimidazol-3-ium-1-yl)ethyl]ethanamine.
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)-N,N-bis[2-(3-methylimidazol-3-ium-1-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 88562344 |
| Molecular Formula | C18H30N7+3 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)-N,N-bis[2-(3-methylimidazol-3-ium-1-yl)ethyl]ethanamine |
| SMILES | C[n+]1ccn(CCN(CCn2cc[n+](C)c2)CCn2cc[n+](C)c2)c1 |
| InChI | InChI=1S/C18H30N7/c1-19-4-7-23(16-19)13-10-22(11-14-24-8-5-20(2)17-24)12-15-25-9-6-21(3)18-25/h4-9,16-18H,10-15H2,1-3H3/q+3 |
| InChIKey | HRHOPWOXBYDNQK-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 29.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|