C11H21N4O+ — CID 19969340
2-(diethylamino)-N-[(3-methylimidazol-3-ium-1-yl)methyl]acetamide (PubChem CID 19969340) has the molecular formula C11H21N4O+ and a molecular weight of 225.32 g/mol. Its IUPAC name is 2-(diethylamino)-N-[(3-methylimidazol-3-ium-1-yl)methyl]acetamide.
| Compound Name | 2-(diethylamino)-N-[(3-methylimidazol-3-ium-1-yl)methyl]acetamide |
|---|---|
| PubChem CID | 19969340 |
| Molecular Formula | C11H21N4O+ |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2-(diethylamino)-N-[(3-methylimidazol-3-ium-1-yl)methyl]acetamide |
| SMILES | CCN(CC)CC(=O)NCn1cc[n+](C)c1 |
| InChI | InChI=1S/C11H20N4O/c1-4-14(5-2)8-11(16)12-9-15-7-6-13(3)10-15/h6-7,10H,4-5,8-9H2,1-3H3/p+1 |
| InChIKey | DZHJXXAQANLHJG-UHFFFAOYSA-O |
| XLogP | -0.27 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|