C18H22Cl2N6O3 — CID 18552056
N-[2-hydroxy-3-[[2-(3-methylimidazol-3-ium-1-yl)acetyl]amino]phenyl]-2-(3-methylimidazol-3-ium-1-yl)acetamide dichloride (PubChem CID 18552056) has the molecular formula C18H22Cl2N6O3 and a molecular weight of 441.32 g/mol. Its IUPAC name is N-[2-hydroxy-3-[[2-(3-methylimidazol-3-ium-1-yl)acetyl]amino]phenyl]-2-(3-methylimidazol-3-ium-1-yl)acetamide dichloride.
| Compound Name | N-[2-hydroxy-3-[[2-(3-methylimidazol-3-ium-1-yl)acetyl]amino]phenyl]-2-(3-methylimidazol-3-ium-1-yl)acetamide dichloride |
|---|---|
| PubChem CID | 18552056 |
| Molecular Formula | C18H22Cl2N6O3 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-[2-hydroxy-3-[[2-(3-methylimidazol-3-ium-1-yl)acetyl]amino]phenyl]-2-(3-methylimidazol-3-ium-1-yl)acetamide dichloride |
| SMILES | C[n+]1ccn(CC(=O)Nc2cccc(NC(=O)Cn3cc[n+](C)c3)c2O)c1.[Cl-].[Cl-] |
| InChI | InChI=1S/C18H20N6O3.2ClH/c1-21-6-8-23(12-21)10-16(25)19-14-4-3-5-15(18(14)27)20-17(26)11-24-9-7-22(2)13-24;;/h3-9,12-13H,10-11H2,1-2H3,(H-2,19,20,25,26,27);2*1H |
| InChIKey | OTIZFQNXYUEHHR-UHFFFAOYSA-N |
| XLogP | -6.07 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | -6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|