C14H20N5O+ — CID 18424719
N-[2-(2-aminoanilino)ethyl]-2-(3-methylimidazol-3-ium-1-yl)acetamide (PubChem CID 18424719) has the molecular formula C14H20N5O+ and a molecular weight of 274.35 g/mol. Its IUPAC name is N-[2-(2-aminoanilino)ethyl]-2-(3-methylimidazol-3-ium-1-yl)acetamide.
| Compound Name | N-[2-(2-aminoanilino)ethyl]-2-(3-methylimidazol-3-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 18424719 |
| Molecular Formula | C14H20N5O+ |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[2-(2-aminoanilino)ethyl]-2-(3-methylimidazol-3-ium-1-yl)acetamide |
| SMILES | C[n+]1ccn(CC(=O)NCCNc2ccccc2N)c1 |
| InChI | InChI=1S/C14H19N5O/c1-18-8-9-19(11-18)10-14(20)17-7-6-16-13-5-3-2-4-12(13)15/h2-5,8-9,11,16H,6-7,10,15H2,1H3/p+1 |
| InChIKey | UVYXPHJVZYYZKF-UHFFFAOYSA-O |
| XLogP | 0.12 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|