C14H21N4O+ — CID 87787836
2-[3-[3-(2-aminoanilino)propyl]imidazol-3-ium-1-yl]ethanol (PubChem CID 87787836) has the molecular formula C14H21N4O+ and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-[3-[3-(2-aminoanilino)propyl]imidazol-3-ium-1-yl]ethanol.
| Compound Name | 2-[3-[3-(2-aminoanilino)propyl]imidazol-3-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 87787836 |
| Molecular Formula | C14H21N4O+ |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-[3-[3-(2-aminoanilino)propyl]imidazol-3-ium-1-yl]ethanol |
| SMILES | Nc1ccccc1NCCC[n+]1ccn(CCO)c1 |
| InChI | InChI=1S/C14H21N4O/c15-13-4-1-2-5-14(13)16-6-3-7-17-8-9-18(12-17)10-11-19/h1-2,4-5,8-9,12,16,19H,3,6-7,10-11,15H2/q+1 |
| InChIKey | NHQLPVWJUHGZRM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 67.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|