C15H21N6O+ — CID 22723427
2-[3-[3-[(3-aminopyrazolo[1,5-a]pyridin-5-yl)amino]propyl]imidazol-3-ium-1-yl]ethanol (PubChem CID 22723427) has the molecular formula C15H21N6O+ and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[3-[3-[(3-aminopyrazolo[1,5-a]pyridin-5-yl)amino]propyl]imidazol-3-ium-1-yl]ethanol.
| Compound Name | 2-[3-[3-[(3-aminopyrazolo[1,5-a]pyridin-5-yl)amino]propyl]imidazol-3-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 22723427 |
| Molecular Formula | C15H21N6O+ |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-[3-[3-[(3-aminopyrazolo[1,5-a]pyridin-5-yl)amino]propyl]imidazol-3-ium-1-yl]ethanol |
| SMILES | Nc1cnn2ccc(NCCC[n+]3ccn(CCO)c3)cc12 |
| InChI | InChI=1S/C15H21N6O/c16-14-11-18-21-5-2-13(10-15(14)21)17-3-1-4-19-6-7-20(12-19)8-9-22/h2,5-7,10-12,17,22H,1,3-4,8-9,16H2/q+1 |
| InChIKey | HOFOEQMDBCFMDY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|