About 5-iodopyrazolo[1,5-a]pyridin-3-amine
5-iodopyrazolo[1,5-a]pyridin-3-amine (PubChem CID 130048259) has the molecular formula C7H6IN3
and a molecular weight of 259.05 g/mol. Its IUPAC name is 5-iodopyrazolo[1,5-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 5-iodopyrazolo[1,5-a]pyridin-3-amine |
| PubChem CID | 130048259 |
| Molecular Formula | C7H6IN3 |
| Molecular Weight | 259.05 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | 5-iodopyrazolo[1,5-a]pyridin-3-amine |
| SMILES | Nc1cnn2ccc(I)cc12 |
| InChI | InChI=1S/C7H6IN3/c8-5-1-2-11-7(3-5)6(9)4-10-11/h1-4H,9H2 |
| InChIKey | NIUIBMJYCMKCKU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.05 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodopyrazolo[1,5-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodopyrazolo[1,5-a]pyridin-3-amine?
The IUPAC name of 5-iodopyrazolo[1,5-a]pyridin-3-amine (CID 130048259) is 5-iodopyrazolo[1,5-a]pyridin-3-amine.
What is the SMILES notation for 5-iodopyrazolo[1,5-a]pyridin-3-amine?
The canonical SMILES for 5-iodopyrazolo[1,5-a]pyridin-3-amine is Nc1cnn2ccc(I)cc12.
What is the InChIKey of 5-iodopyrazolo[1,5-a]pyridin-3-amine?
The InChIKey is NIUIBMJYCMKCKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6IN3/c8-5-1-2-11-7(3-5)6(9)4-10-11/h1-4H,9H2.
What are the key properties of 5-iodopyrazolo[1,5-a]pyridin-3-amine?
5-iodopyrazolo[1,5-a]pyridin-3-amine has a molecular weight of 259.05 g/mol, XLogP of 1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodopyrazolo[1,5-a]pyridin-3-amine is sourced from PubChem (CID 130048259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).