C7H6IN3 — CID 130048259
5-iodopyrazolo[1,5-a]pyridin-3-amine (PubChem CID 130048259) has the molecular formula C7H6IN3 and a molecular weight of 259.05 g/mol. Its IUPAC name is 5-iodopyrazolo[1,5-a]pyridin-3-amine.
| Compound Name | 5-iodopyrazolo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 130048259 |
| Molecular Formula | C7H6IN3 |
| Molecular Weight | 259.05 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | 5-iodopyrazolo[1,5-a]pyridin-3-amine |
| SMILES | Nc1cnn2ccc(I)cc12 |
| InChI | InChI=1S/C7H6IN3/c8-5-1-2-11-7(3-5)6(9)4-10-11/h1-4H,9H2 |
| InChIKey | NIUIBMJYCMKCKU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.05 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|