C6H6N4 — CID 92845208
pyrrolo[2,1-f][1,2,4]triazin-5-amine (PubChem CID 92845208) has the molecular formula C6H6N4 and a molecular weight of 134.14 g/mol. Its IUPAC name is pyrrolo[2,1-f][1,2,4]triazin-5-amine.
| Compound Name | pyrrolo[2,1-f][1,2,4]triazin-5-amine |
|---|---|
| PubChem CID | 92845208 |
| Molecular Formula | C6H6N4 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | pyrrolo[2,1-f][1,2,4]triazin-5-amine |
| SMILES | Nc1ccn2ncncc12 |
| InChI | InChI=1S/C6H6N4/c7-5-1-2-10-6(5)3-8-4-9-10/h1-4H,7H2 |
| InChIKey | YTYJVFNNYBILSC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |