About pyrazolo[1,5-a]pyridine-4,5-diamine
pyrazolo[1,5-a]pyridine-4,5-diamine (PubChem CID 121417759) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is pyrazolo[1,5-a]pyridine-4,5-diamine.
Molecular Properties
| Compound Name | pyrazolo[1,5-a]pyridine-4,5-diamine |
| PubChem CID | 121417759 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | pyrazolo[1,5-a]pyridine-4,5-diamine |
| SMILES | Nc1ccn2nccc2c1N |
| InChI | InChI=1S/C7H8N4/c8-5-2-4-11-6(7(5)9)1-3-10-11/h1-4H,8-9H2 |
| InChIKey | GATJKUZWGGYNJQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrazolo[1,5-a]pyridine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[1,5-a]pyridine-4,5-diamine?
The IUPAC name of pyrazolo[1,5-a]pyridine-4,5-diamine (CID 121417759) is pyrazolo[1,5-a]pyridine-4,5-diamine.
What is the SMILES notation for pyrazolo[1,5-a]pyridine-4,5-diamine?
The canonical SMILES for pyrazolo[1,5-a]pyridine-4,5-diamine is Nc1ccn2nccc2c1N.
What is the InChIKey of pyrazolo[1,5-a]pyridine-4,5-diamine?
The InChIKey is GATJKUZWGGYNJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c8-5-2-4-11-6(7(5)9)1-3-10-11/h1-4H,8-9H2.
What are the key properties of pyrazolo[1,5-a]pyridine-4,5-diamine?
pyrazolo[1,5-a]pyridine-4,5-diamine has a molecular weight of 148.17 g/mol, XLogP of 0.50, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[1,5-a]pyridine-4,5-diamine is sourced from PubChem (CID 121417759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).