C8H8N2S — CID 91132662
4-methylsulfanylpyrrolo[1,2-b]pyridazine (PubChem CID 91132662) has the molecular formula C8H8N2S and a molecular weight of 164.23 g/mol. Its IUPAC name is 4-methylsulfanylpyrrolo[1,2-b]pyridazine.
| Compound Name | 4-methylsulfanylpyrrolo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 91132662 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 4-methylsulfanylpyrrolo[1,2-b]pyridazine |
| SMILES | CSc1ccnn2cccc12 |
| InChI | InChI=1S/C8H8N2S/c1-11-8-4-5-9-10-6-2-3-7(8)10/h2-6H,1H3 |
| InChIKey | HZUKLMAPVZQQCW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |