C11H15N3 — CID 89309682
N-[(2S)-butan-2-yl]pyrrolo[1,2-b]pyridazin-4-amine (PubChem CID 89309682) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]pyrrolo[1,2-b]pyridazin-4-amine.
| Compound Name | N-[(2S)-butan-2-yl]pyrrolo[1,2-b]pyridazin-4-amine |
|---|---|
| PubChem CID | 89309682 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | N-[(2S)-butan-2-yl]pyrrolo[1,2-b]pyridazin-4-amine |
| SMILES | CC[C@H](C)Nc1ccnn2cccc12 |
| InChI | InChI=1S/C11H15N3/c1-3-9(2)13-10-6-7-12-14-8-4-5-11(10)14/h4-9,13H,3H2,1-2H3/t9-/m0/s1 |
| InChIKey | QHSDQSMTRCQERF-VIFPVBQESA-N |
| XLogP | 2.54 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |