2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid

C10H10N2O2 — CID 83877395

IUPAC2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid
SMILESCC(C(=O)O)c1cccn2nccc12
InChIInChI=1S/C10H10N2O2/c1-7(10(13)14)8-3-2-6-12-9(8)4-5-11-12/h2-7H,1H3,(H,13,14)
InChIKeyCULFQVILNODIBC-UHFFFAOYSA-N
MW190.20 g/mol
LogP1.52
Rot. Bonds2

About 2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid

2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid (PubChem CID 83877395) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid.

Molecular Properties

Compound Name2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid
PubChem CID83877395
Molecular FormulaC10H10N2O2
Molecular Weight190.20 g/mol
Exact Mass190.07
IUPAC Name2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid
SMILESCC(C(=O)O)c1cccn2nccc12
InChIInChI=1S/C10H10N2O2/c1-7(10(13)14)8-3-2-6-12-9(8)4-5-11-12/h2-7H,1H3,(H,13,14)
InChIKeyCULFQVILNODIBC-UHFFFAOYSA-N
XLogP1.52
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.20
LogP ≤ 51.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid?
The IUPAC name of 2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid (CID 83877395) is 2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid.
What is the SMILES notation for 2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid?
The canonical SMILES for 2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid is CC(C(=O)O)c1cccn2nccc12.
What is the InChIKey of 2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid?
The InChIKey is CULFQVILNODIBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-7(10(13)14)8-3-2-6-12-9(8)4-5-11-12/h2-7H,1H3,(H,13,14).
What are the key properties of 2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid?
2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid has a molecular weight of 190.20 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazolo[1,5-a]pyridin-4-ylpropanoic acid is sourced from PubChem (CID 83877395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).