C11H13N3O2 — CID 104734431
2-pyrazolo[1,5-a]pyrazin-4-ylpentanoic acid (PubChem CID 104734431) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-pyrazolo[1,5-a]pyrazin-4-ylpentanoic acid.
| Compound Name | 2-pyrazolo[1,5-a]pyrazin-4-ylpentanoic acid |
|---|---|
| PubChem CID | 104734431 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-pyrazolo[1,5-a]pyrazin-4-ylpentanoic acid |
| SMILES | CCCC(C(=O)O)c1nccn2nccc12 |
| InChI | InChI=1S/C11H13N3O2/c1-2-3-8(11(15)16)10-9-4-5-13-14(9)7-6-12-10/h4-8H,2-3H2,1H3,(H,15,16) |
| InChIKey | WFYSKDFJHRKARE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |