2-imidazo[1,2-a]pyridin-5-ylpentanoic acid

C12H14N2O2 — CID 102626945

IUPAC2-imidazo[1,2-a]pyridin-5-ylpentanoic acid
SMILESCCCC(C(=O)O)c1cccc2nccn12
InChIInChI=1S/C12H14N2O2/c1-2-4-9(12(15)16)10-5-3-6-11-13-7-8-14(10)11/h3,5-9H,2,4H2,1H3,(H,15,16)
InChIKeySALGLKJPIPXEHT-UHFFFAOYSA-N
MW218.26 g/mol
LogP2.30
Rot. Bonds4

About 2-imidazo[1,2-a]pyridin-5-ylpentanoic acid

2-imidazo[1,2-a]pyridin-5-ylpentanoic acid (PubChem CID 102626945) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyridin-5-ylpentanoic acid.

Molecular Properties

Compound Name2-imidazo[1,2-a]pyridin-5-ylpentanoic acid
PubChem CID102626945
Molecular FormulaC12H14N2O2
Molecular Weight218.26 g/mol
Exact Mass218.11
IUPAC Name2-imidazo[1,2-a]pyridin-5-ylpentanoic acid
SMILESCCCC(C(=O)O)c1cccc2nccn12
InChIInChI=1S/C12H14N2O2/c1-2-4-9(12(15)16)10-5-3-6-11-13-7-8-14(10)11/h3,5-9H,2,4H2,1H3,(H,15,16)
InChIKeySALGLKJPIPXEHT-UHFFFAOYSA-N
XLogP2.30
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.26
LogP ≤ 52.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-imidazo[1,2-a]pyridin-5-ylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-imidazo[1,2-a]pyridin-5-ylpentanoic acid?
The IUPAC name of 2-imidazo[1,2-a]pyridin-5-ylpentanoic acid (CID 102626945) is 2-imidazo[1,2-a]pyridin-5-ylpentanoic acid.
What is the SMILES notation for 2-imidazo[1,2-a]pyridin-5-ylpentanoic acid?
The canonical SMILES for 2-imidazo[1,2-a]pyridin-5-ylpentanoic acid is CCCC(C(=O)O)c1cccc2nccn12.
What is the InChIKey of 2-imidazo[1,2-a]pyridin-5-ylpentanoic acid?
The InChIKey is SALGLKJPIPXEHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-2-4-9(12(15)16)10-5-3-6-11-13-7-8-14(10)11/h3,5-9H,2,4H2,1H3,(H,15,16).
What are the key properties of 2-imidazo[1,2-a]pyridin-5-ylpentanoic acid?
2-imidazo[1,2-a]pyridin-5-ylpentanoic acid has a molecular weight of 218.26 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[1,2-a]pyridin-5-ylpentanoic acid is sourced from PubChem (CID 102626945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).