About ethyl 2-[imidazo[1,2-a]pyridin-5-yl(propan-2-yl)amino]acetate
ethyl 2-[imidazo[1,2-a]pyridin-5-yl(propan-2-yl)amino]acetate (PubChem CID 102626836) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is ethyl 2-[imidazo[1,2-a]pyridin-5-yl(propan-2-yl)amino]acetate.
Analyze ethyl 2-[imidazo[1,2-a]pyridin-5-yl(propan-2-yl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[imidazo[1,2-a]pyridin-5-yl(propan-2-yl)amino]acetate?
The IUPAC name of ethyl 2-[imidazo[1,2-a]pyridin-5-yl(propan-2-yl)amino]acetate (CID 102626836) is ethyl 2-[imidazo[1,2-a]pyridin-5-yl(propan-2-yl)amino]acetate.
What is the SMILES notation for ethyl 2-[imidazo[1,2-a]pyridin-5-yl(propan-2-yl)amino]acetate?
The canonical SMILES for ethyl 2-[imidazo[1,2-a]pyridin-5-yl(propan-2-yl)amino]acetate is CCOC(=O)CN(c1cccc2nccn12)C(C)C.
What is the InChIKey of ethyl 2-[imidazo[1,2-a]pyridin-5-yl(propan-2-yl)amino]acetate?
The InChIKey is ZMFRFCGUOPPSCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2/c1-4-19-14(18)10-17(11(2)3)13-7-5-6-12-15-8-9-16(12)13/h5-9,11H,4,10H2,1-3H3.
What are the key properties of ethyl 2-[imidazo[1,2-a]pyridin-5-yl(propan-2-yl)amino]acetate?
ethyl 2-[imidazo[1,2-a]pyridin-5-yl(propan-2-yl)amino]acetate has a molecular weight of 261.32 g/mol, XLogP of 2.11, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[imidazo[1,2-a]pyridin-5-yl(propan-2-yl)amino]acetate is sourced from PubChem (CID 102626836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).