C11H12N2O2S — CID 102625233
2-imidazo[1,2-a]pyridin-5-ylsulfanyl-2-methylpropanoic acid (PubChem CID 102625233) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-2-methylpropanoic acid.
| Compound Name | 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 102625233 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2-imidazo[1,2-a]pyridin-5-ylsulfanyl-2-methylpropanoic acid |
| SMILES | CC(C)(Sc1cccc2nccn12)C(=O)O |
| InChI | InChI=1S/C11H12N2O2S/c1-11(2,10(14)15)16-9-5-3-4-8-12-6-7-13(8)9/h3-7H,1-2H3,(H,14,15) |
| InChIKey | LGUPMDXLUWJDEL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |