C13H18ClN3O2S — CID 23362877
propan-2-yl N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)carbamate;hydrochloride (PubChem CID 23362877) has the molecular formula C13H18ClN3O2S and a molecular weight of 315.83 g/mol. Its IUPAC name is propan-2-yl N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)carbamate;hydrochloride.
| Compound Name | propan-2-yl N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 23362877 |
| Molecular Formula | C13H18ClN3O2S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | propan-2-yl N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)carbamate;hydrochloride |
| SMILES | CC(C)OC(=O)NCCSc1cccc2nccn12.Cl |
| InChI | InChI=1S/C13H17N3O2S.ClH/c1-10(2)18-13(17)15-7-9-19-12-5-3-4-11-14-6-8-16(11)12;/h3-6,8,10H,7,9H2,1-2H3,(H,15,17);1H |
| InChIKey | APAGPGJEMVDFGR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|