C17H20ClN3O2S3 — CID 73472911
5-(ethylsulfanylmethylidene)-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 73472911) has the molecular formula C17H20ClN3O2S3 and a molecular weight of 430.02 g/mol. Its IUPAC name is 5-(ethylsulfanylmethylidene)-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 5-(ethylsulfanylmethylidene)-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 73472911 |
| Molecular Formula | C17H20ClN3O2S3 |
| Molecular Weight | 430.02 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 5-(ethylsulfanylmethylidene)-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | CCSC=C1SC(=O)N(CCCCSc2cccc3nccn23)C1=O.Cl |
| InChI | InChI=1S/C17H19N3O2S3.ClH/c1-2-23-12-13-16(21)20(17(22)25-13)9-3-4-11-24-15-7-5-6-14-18-8-10-19(14)15;/h5-8,10,12H,2-4,9,11H2,1H3;1H |
| InChIKey | LWPKFEAVLANQKT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.02 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|