C19H17N3O2S3 — CID 57227886
3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 57227886) has the molecular formula C19H17N3O2S3 and a molecular weight of 415.57 g/mol. Its IUPAC name is 3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 57227886 |
| Molecular Formula | C19H17N3O2S3 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2cccs2)C(=O)N1CCCCSc1cccc2nccn12 |
| InChI | InChI=1S/C19H17N3O2S3/c23-18-15(13-14-5-4-12-25-14)27-19(24)22(18)9-1-2-11-26-17-7-3-6-16-20-8-10-21(16)17/h3-8,10,12-13H,1-2,9,11H2 |
| InChIKey | MZWOEAWCTOIEGW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|