C21H19Cl2N3O3S — CID 18936649
(5Z)-5-[(4-chlorophenyl)methylidene]-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-oxazolidine-2,4-dione;hydrochloride (PubChem CID 18936649) has the molecular formula C21H19Cl2N3O3S and a molecular weight of 464.37 g/mol. Its IUPAC name is (5Z)-5-[(4-chlorophenyl)methylidene]-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-oxazolidine-2,4-dione;hydrochloride.
| Compound Name | (5Z)-5-[(4-chlorophenyl)methylidene]-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-oxazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 18936649 |
| Molecular Formula | C21H19Cl2N3O3S |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | (5Z)-5-[(4-chlorophenyl)methylidene]-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-oxazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1O/C(=C\c2ccc(Cl)cc2)C(=O)N1CCCCSc1cccc2nccn12 |
| InChI | InChI=1S/C21H18ClN3O3S.ClH/c22-16-8-6-15(7-9-16)14-17-20(26)25(21(27)28-17)11-1-2-13-29-19-5-3-4-18-23-10-12-24(18)19;/h3-10,12,14H,1-2,11,13H2;1H/b17-14-; |
| InChIKey | VVLIEGFESLJCKO-SBBUSYCLSA-N |
| XLogP | 5.30 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|