About N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride
N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride (PubChem CID 67745966) has the molecular formula C17H18Cl2N4OS
and a molecular weight of 397.33 g/mol. Its IUPAC name is N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride.
Molecular Properties
| Compound Name | N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride |
| PubChem CID | 67745966 |
| Molecular Formula | C17H18Cl2N4OS |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(C=Cc1cccnc1)NCCSc1cccc2nccn12 |
| InChI | InChI=1S/C17H16N4OS.2ClH/c22-16(7-6-14-3-2-8-18-13-14)20-10-12-23-17-5-1-4-15-19-9-11-21(15)17;;/h1-9,11,13H,10,12H2,(H,20,22);2*1H |
| InChIKey | WSEUHVCCZRRQLX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride?
The IUPAC name of N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride (CID 67745966) is N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride.
What is the SMILES notation for N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride?
The canonical SMILES for N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride is Cl.Cl.O=C(C=Cc1cccnc1)NCCSc1cccc2nccn12.
What is the InChIKey of N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride?
The InChIKey is WSEUHVCCZRRQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4OS.2ClH/c22-16(7-6-14-3-2-8-18-13-14)20-10-12-23-17-5-1-4-15-19-9-11-21(15)17;;/h1-9,11,13H,10,12H2,(H,20,22);2*1H.
What are the key properties of N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride?
N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride has a molecular weight of 397.33 g/mol, XLogP of 3.49, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride is sourced from PubChem (CID 67745966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).