C17H18Cl2N4OS — CID 67745966
N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride (PubChem CID 67745966) has the molecular formula C17H18Cl2N4OS and a molecular weight of 397.33 g/mol. Its IUPAC name is N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride.
| Compound Name | N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride |
|---|---|
| PubChem CID | 67745966 |
| Molecular Formula | C17H18Cl2N4OS |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-3-pyridin-3-ylprop-2-enamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(C=Cc1cccnc1)NCCSc1cccc2nccn12 |
| InChI | InChI=1S/C17H16N4OS.2ClH/c22-16(7-6-14-3-2-8-18-13-14)20-10-12-23-17-5-1-4-15-19-9-11-21(15)17;;/h1-9,11,13H,10,12H2,(H,20,22);2*1H |
| InChIKey | WSEUHVCCZRRQLX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|