C19H20N2O2 — CID 20701388
(E)-N-[2-(3-prop-2-enoxyphenyl)ethyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 20701388) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (E)-N-[2-(3-prop-2-enoxyphenyl)ethyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[2-(3-prop-2-enoxyphenyl)ethyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 20701388 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (E)-N-[2-(3-prop-2-enoxyphenyl)ethyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | C=CCOc1cccc(CCNC(=O)/C=C/c2cccnc2)c1 |
| InChI | InChI=1S/C19H20N2O2/c1-2-13-23-18-7-3-5-16(14-18)10-12-21-19(22)9-8-17-6-4-11-20-15-17/h2-9,11,14-15H,1,10,12-13H2,(H,21,22)/b9-8+ |
| InChIKey | KHTNQXPQZIXNLC-CMDGGOBGSA-N |
| XLogP | 3.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|