C21H25N3O3 — CID 20701411
(E)-N-[2-[3-[2-oxo-2-(propylamino)ethoxy]phenyl]ethyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 20701411) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is (E)-N-[2-[3-[2-oxo-2-(propylamino)ethoxy]phenyl]ethyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[2-[3-[2-oxo-2-(propylamino)ethoxy]phenyl]ethyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 20701411 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (E)-N-[2-[3-[2-oxo-2-(propylamino)ethoxy]phenyl]ethyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CCCNC(=O)COc1cccc(CCNC(=O)/C=C/c2cccnc2)c1 |
| InChI | InChI=1S/C21H25N3O3/c1-2-11-23-21(26)16-27-19-7-3-5-17(14-19)10-13-24-20(25)9-8-18-6-4-12-22-15-18/h3-9,12,14-15H,2,10-11,13,16H2,1H3,(H,23,26)(H,24,25)/b9-8+ |
| InChIKey | YFGICDSUCOPXHC-CMDGGOBGSA-N |
| XLogP | 2.36 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|