C20H19ClN4O2S2 — CID 86753350
3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-5-(pyridin-2-ylmethylidene)-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 86753350) has the molecular formula C20H19ClN4O2S2 and a molecular weight of 446.99 g/mol. Its IUPAC name is 3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-5-(pyridin-2-ylmethylidene)-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-5-(pyridin-2-ylmethylidene)-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 86753350 |
| Molecular Formula | C20H19ClN4O2S2 |
| Molecular Weight | 446.99 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-5-(pyridin-2-ylmethylidene)-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1SC(=Cc2ccccn2)C(=O)N1CCCCSc1cccc2nccn12 |
| InChI | InChI=1S/C20H18N4O2S2.ClH/c25-19-16(14-15-6-1-2-9-21-15)28-20(26)24(19)11-3-4-13-27-18-8-5-7-17-22-10-12-23(17)18;/h1-2,5-10,12,14H,3-4,11,13H2;1H |
| InChIKey | BMSCWBSMMUVHBZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.99 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|