C16H17N3O2S2 — CID 57121133
5-butylidene-3-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 57121133) has the molecular formula C16H17N3O2S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 5-butylidene-3-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-butylidene-3-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 57121133 |
| Molecular Formula | C16H17N3O2S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 5-butylidene-3-(2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCCC=C1SC(=O)N(CCSc2cccc3nccn23)C1=O |
| InChI | InChI=1S/C16H17N3O2S2/c1-2-3-5-12-15(20)19(16(21)23-12)10-11-22-14-7-4-6-13-17-8-9-18(13)14/h4-9H,2-3,10-11H2,1H3 |
| InChIKey | LKUZYWHGVYZPAH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|