C20H26Cl2N4O2S2 — CID 18936883
(5Z)-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-5-(piperidin-1-ylmethylidene)-1,3-thiazolidine-2,4-dione;dihydrochloride (PubChem CID 18936883) has the molecular formula C20H26Cl2N4O2S2 and a molecular weight of 489.49 g/mol. Its IUPAC name is (5Z)-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-5-(piperidin-1-ylmethylidene)-1,3-thiazolidine-2,4-dione;dihydrochloride.
| Compound Name | (5Z)-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-5-(piperidin-1-ylmethylidene)-1,3-thiazolidine-2,4-dione;dihydrochloride |
|---|---|
| PubChem CID | 18936883 |
| Molecular Formula | C20H26Cl2N4O2S2 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | (5Z)-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-5-(piperidin-1-ylmethylidene)-1,3-thiazolidine-2,4-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C1S/C(=C\N2CCCCC2)C(=O)N1CCCCSc1cccc2nccn12 |
| InChI | InChI=1S/C20H24N4O2S2.2ClH/c25-19-16(15-22-10-2-1-3-11-22)28-20(26)24(19)12-4-5-14-27-18-8-6-7-17-21-9-13-23(17)18;;/h6-9,13,15H,1-5,10-12,14H2;2*1H/b16-15-;; |
| InChIKey | USCFXHBQVVQRRN-NDXGFPCWSA-N |
| XLogP | 5.07 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|