C15H15N3O2S2 — CID 18936822
(5E)-5-butylidene-3-(imidazo[1,2-a]pyridin-5-ylsulfanylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 18936822) has the molecular formula C15H15N3O2S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is (5E)-5-butylidene-3-(imidazo[1,2-a]pyridin-5-ylsulfanylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-butylidene-3-(imidazo[1,2-a]pyridin-5-ylsulfanylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18936822 |
| Molecular Formula | C15H15N3O2S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | (5E)-5-butylidene-3-(imidazo[1,2-a]pyridin-5-ylsulfanylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCC/C=C1/SC(=O)N(CSc2cccc3nccn23)C1=O |
| InChI | InChI=1S/C15H15N3O2S2/c1-2-3-5-11-14(19)18(15(20)22-11)10-21-13-7-4-6-12-16-8-9-17(12)13/h4-9H,2-3,10H2,1H3/b11-5+ |
| InChIKey | RKJOPAYGRUALDA-VZUCSPMQSA-N |
| XLogP | 3.76 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|