C17H20N4O2S2 — CID 57015719
5-butylidene-3-(4-imidazo[1,2-c]pyrimidin-5-ylsulfanylbutyl)-1,3-thiazolidine-2,4-dione (PubChem CID 57015719) has the molecular formula C17H20N4O2S2 and a molecular weight of 376.51 g/mol. Its IUPAC name is 5-butylidene-3-(4-imidazo[1,2-c]pyrimidin-5-ylsulfanylbutyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-butylidene-3-(4-imidazo[1,2-c]pyrimidin-5-ylsulfanylbutyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 57015719 |
| Molecular Formula | C17H20N4O2S2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 5-butylidene-3-(4-imidazo[1,2-c]pyrimidin-5-ylsulfanylbutyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCCC=C1SC(=O)N(CCCCSc2nccc3nccn23)C1=O |
| InChI | InChI=1S/C17H20N4O2S2/c1-2-3-6-13-15(22)21(17(23)25-13)10-4-5-12-24-16-19-8-7-14-18-9-11-20(14)16/h6-9,11H,2-5,10,12H2,1H3 |
| InChIKey | RTNDHJLIMZXEFW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|