C18H21BrClN3O2S2 — CID 73472890
3-[4-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylbutyl]-5-butylidene-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 73472890) has the molecular formula C18H21BrClN3O2S2 and a molecular weight of 490.88 g/mol. Its IUPAC name is 3-[4-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylbutyl]-5-butylidene-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-[4-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylbutyl]-5-butylidene-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 73472890 |
| Molecular Formula | C18H21BrClN3O2S2 |
| Molecular Weight | 490.88 g/mol |
| Exact Mass | 488.99 |
| IUPAC Name | 3-[4-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylbutyl]-5-butylidene-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | CCCC=C1SC(=O)N(CCCCSc2cccc3ncc(Br)n23)C1=O.Cl |
| InChI | InChI=1S/C18H20BrN3O2S2.ClH/c1-2-3-7-13-17(23)21(18(24)26-13)10-4-5-11-25-16-9-6-8-15-20-12-14(19)22(15)16;/h6-9,12H,2-5,10-11H2,1H3;1H |
| InChIKey | YXGDPKAKZWIHJG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.88 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|