C20H26ClN3O2S2 — CID 18936705
(5E)-5-hexylidene-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 18936705) has the molecular formula C20H26ClN3O2S2 and a molecular weight of 440.03 g/mol. Its IUPAC name is (5E)-5-hexylidene-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | (5E)-5-hexylidene-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 18936705 |
| Molecular Formula | C20H26ClN3O2S2 |
| Molecular Weight | 440.03 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | (5E)-5-hexylidene-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | CCCCC/C=C1/SC(=O)N(CCCCSc2cccc3nccn23)C1=O.Cl |
| InChI | InChI=1S/C20H25N3O2S2.ClH/c1-2-3-4-5-9-16-19(24)23(20(25)27-16)13-6-7-15-26-18-11-8-10-17-21-12-14-22(17)18;/h8-12,14H,2-7,13,15H2,1H3;1H/b16-9+; |
| InChIKey | XRLDIZRVMXCBFM-QOVZSLTQSA-N |
| XLogP | 5.79 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.03 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|