C21H30Cl2N4O2S2 — CID 73472906
5-butylidene-3-[4-[3-[(dimethylamino)methyl]imidazo[1,2-a]pyridin-5-yl]sulfanylbutyl]-1,3-thiazolidine-2,4-dione;dihydrochloride (PubChem CID 73472906) has the molecular formula C21H30Cl2N4O2S2 and a molecular weight of 505.54 g/mol. Its IUPAC name is 5-butylidene-3-[4-[3-[(dimethylamino)methyl]imidazo[1,2-a]pyridin-5-yl]sulfanylbutyl]-1,3-thiazolidine-2,4-dione;dihydrochloride.
| Compound Name | 5-butylidene-3-[4-[3-[(dimethylamino)methyl]imidazo[1,2-a]pyridin-5-yl]sulfanylbutyl]-1,3-thiazolidine-2,4-dione;dihydrochloride |
|---|---|
| PubChem CID | 73472906 |
| Molecular Formula | C21H30Cl2N4O2S2 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 5-butylidene-3-[4-[3-[(dimethylamino)methyl]imidazo[1,2-a]pyridin-5-yl]sulfanylbutyl]-1,3-thiazolidine-2,4-dione;dihydrochloride |
| SMILES | CCCC=C1SC(=O)N(CCCCSc2cccc3ncc(CN(C)C)n23)C1=O.Cl.Cl |
| InChI | InChI=1S/C21H28N4O2S2.2ClH/c1-4-5-9-17-20(26)24(21(27)29-17)12-6-7-13-28-19-11-8-10-18-22-14-16(25(18)19)15-23(2)3;;/h8-11,14H,4-7,12-13,15H2,1-3H3;2*1H |
| InChIKey | CPVYFUJDTHEBAC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|