C16H16N4O2S — CID 67745982
2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-(pyridin-2-ylmethyl)carbamate (PubChem CID 67745982) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-(pyridin-2-ylmethyl)carbamate.
| Compound Name | 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-(pyridin-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 67745982 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-imidazo[1,2-a]pyridin-5-ylsulfanylethyl N-(pyridin-2-ylmethyl)carbamate |
| SMILES | O=C(NCc1ccccn1)OCCSc1cccc2nccn12 |
| InChI | InChI=1S/C16H16N4O2S/c21-16(19-12-13-4-1-2-7-17-13)22-10-11-23-15-6-3-5-14-18-8-9-20(14)15/h1-9H,10-12H2,(H,19,21) |
| InChIKey | AAWSXBZQQOBJHC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|