About 1-imidazo[1,2-a]pyridin-5-ylethanone
1-imidazo[1,2-a]pyridin-5-ylethanone (PubChem CID 82596119) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 1-imidazo[1,2-a]pyridin-5-ylethanone.
Molecular Properties
| Compound Name | 1-imidazo[1,2-a]pyridin-5-ylethanone |
| PubChem CID | 82596119 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 1-imidazo[1,2-a]pyridin-5-ylethanone |
| SMILES | CC(=O)c1cccc2nccn12 |
| InChI | InChI=1S/C9H8N2O/c1-7(12)8-3-2-4-9-10-5-6-11(8)9/h2-6H,1H3 |
| InChIKey | WIEWMQRUZCIQCE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-imidazo[1,2-a]pyridin-5-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imidazo[1,2-a]pyridin-5-ylethanone?
The IUPAC name of 1-imidazo[1,2-a]pyridin-5-ylethanone (CID 82596119) is 1-imidazo[1,2-a]pyridin-5-ylethanone.
What is the SMILES notation for 1-imidazo[1,2-a]pyridin-5-ylethanone?
The canonical SMILES for 1-imidazo[1,2-a]pyridin-5-ylethanone is CC(=O)c1cccc2nccn12.
What is the InChIKey of 1-imidazo[1,2-a]pyridin-5-ylethanone?
The InChIKey is WIEWMQRUZCIQCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c1-7(12)8-3-2-4-9-10-5-6-11(8)9/h2-6H,1H3.
What are the key properties of 1-imidazo[1,2-a]pyridin-5-ylethanone?
1-imidazo[1,2-a]pyridin-5-ylethanone has a molecular weight of 160.18 g/mol, XLogP of 1.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imidazo[1,2-a]pyridin-5-ylethanone is sourced from PubChem (CID 82596119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).