C10H10N2O — CID 2735255
1-(2-methylimidazo[1,2-a]pyridin-3-yl)ethanone (PubChem CID 2735255) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 1-(2-methylimidazo[1,2-a]pyridin-3-yl)ethanone.
| Compound Name | 1-(2-methylimidazo[1,2-a]pyridin-3-yl)ethanone |
|---|---|
| PubChem CID | 2735255 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 1-(2-methylimidazo[1,2-a]pyridin-3-yl)ethanone |
| SMILES | CC(=O)c1c(C)nc2ccccn12 |
| InChI | InChI=1S/C10H10N2O/c1-7-10(8(2)13)12-6-4-3-5-9(12)11-7/h3-6H,1-2H3 |
| InChIKey | RMDMJJKMOQLKPC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |