C16H12N4O — CID 104732206
4-pyrazolo[1,5-a]pyrazin-4-yloxynaphthalen-1-amine (PubChem CID 104732206) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-pyrazolo[1,5-a]pyrazin-4-yloxynaphthalen-1-amine.
| Compound Name | 4-pyrazolo[1,5-a]pyrazin-4-yloxynaphthalen-1-amine |
|---|---|
| PubChem CID | 104732206 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-pyrazolo[1,5-a]pyrazin-4-yloxynaphthalen-1-amine |
| SMILES | Nc1ccc(Oc2nccn3nccc23)c2ccccc12 |
| InChI | InChI=1S/C16H12N4O/c17-13-5-6-15(12-4-2-1-3-11(12)13)21-16-14-7-8-19-20(14)10-9-18-16/h1-10H,17H2 |
| InChIKey | BWYYRNOWPRMENT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|