C12H12Cl3N3O — CID 44722018
N-(3,4-dichlorophenyl)-2-(3-methylimidazol-3-ium-1-yl)acetamide chloride (PubChem CID 44722018) has the molecular formula C12H12Cl3N3O and a molecular weight of 320.61 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-(3-methylimidazol-3-ium-1-yl)acetamide chloride.
| Compound Name | N-(3,4-dichlorophenyl)-2-(3-methylimidazol-3-ium-1-yl)acetamide chloride |
|---|---|
| PubChem CID | 44722018 |
| Molecular Formula | C12H12Cl3N3O |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-(3-methylimidazol-3-ium-1-yl)acetamide chloride |
| SMILES | C[n+]1ccn(CC(=O)Nc2ccc(Cl)c(Cl)c2)c1.[Cl-] |
| InChI | InChI=1S/C12H11Cl2N3O.ClH/c1-16-4-5-17(8-16)7-12(18)15-9-2-3-10(13)11(14)6-9;/h2-6,8H,7H2,1H3;1H |
| InChIKey | KLWMPFCFNORGLA-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|