C14H17Cl2NO3 — CID 8852326
(3R)-5-(3,4-dichloroanilino)-3-ethyl-3-methyl-5-oxopentanoic acid (PubChem CID 8852326) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is (3R)-5-(3,4-dichloroanilino)-3-ethyl-3-methyl-5-oxopentanoic acid.
| Compound Name | (3R)-5-(3,4-dichloroanilino)-3-ethyl-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 8852326 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (3R)-5-(3,4-dichloroanilino)-3-ethyl-3-methyl-5-oxopentanoic acid |
| SMILES | CC[C@@](C)(CC(=O)O)CC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2NO3/c1-3-14(2,8-13(19)20)7-12(18)17-9-4-5-10(15)11(16)6-9/h4-6H,3,7-8H2,1-2H3,(H,17,18)(H,19,20)/t14-/m1/s1 |
| InChIKey | VYTIFZCBASFWQZ-CQSZACIVSA-N |
| XLogP | 4.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |