C19H25N2O3+ — CID 87471730
2-(3-methylimidazol-3-ium-1-yl)ethyl 2-(3-cyclopentyl-2-hydroxyphenyl)acetate (PubChem CID 87471730) has the molecular formula C19H25N2O3+ and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)ethyl 2-(3-cyclopentyl-2-hydroxyphenyl)acetate.
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 2-(3-cyclopentyl-2-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 87471730 |
| Molecular Formula | C19H25N2O3+ |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 2-(3-cyclopentyl-2-hydroxyphenyl)acetate |
| SMILES | C[n+]1ccn(CCOC(=O)Cc2cccc(C3CCCC3)c2O)c1 |
| InChI | InChI=1S/C19H24N2O3/c1-20-9-10-21(14-20)11-12-24-18(22)13-16-7-4-8-17(19(16)23)15-5-2-3-6-15/h4,7-10,14-15H,2-3,5-6,11-13H2,1H3/p+1 |
| InChIKey | WKIWUXACNRPWGX-UHFFFAOYSA-O |
| XLogP | 2.46 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|