C9H12BF4N3O2 — CID 11659181
2-(3-methylimidazol-3-ium-1-yl)ethyl 2-cyanoacetate tetrafluoroborate (PubChem CID 11659181) has the molecular formula C9H12BF4N3O2 and a molecular weight of 281.02 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)ethyl 2-cyanoacetate tetrafluoroborate.
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 2-cyanoacetate tetrafluoroborate |
|---|---|
| PubChem CID | 11659181 |
| Molecular Formula | C9H12BF4N3O2 |
| Molecular Weight | 281.02 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 2-cyanoacetate tetrafluoroborate |
| SMILES | C[n+]1ccn(CCOC(=O)CC#N)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C9H12N3O2.BF4/c1-11-4-5-12(8-11)6-7-14-9(13)2-3-10;2-1(3,4)5/h4-5,8H,2,6-7H2,1H3;/q+1;-1 |
| InChIKey | PZJQLVFHXZBLDS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.02 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|