C13H13BF3N5O2 — CID 159312036
2-(3-methylimidazol-3-ium-1-yl)ethyl prop-2-enoate;tricyano(trifluoromethyl)boranuide (PubChem CID 159312036) has the molecular formula C13H13BF3N5O2 and a molecular weight of 339.09 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)ethyl prop-2-enoate;tricyano(trifluoromethyl)boranuide.
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl prop-2-enoate;tricyano(trifluoromethyl)boranuide |
|---|---|
| PubChem CID | 159312036 |
| Molecular Formula | C13H13BF3N5O2 |
| Molecular Weight | 339.09 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl prop-2-enoate;tricyano(trifluoromethyl)boranuide |
| SMILES | C=CC(=O)OCCn1cc[n+](C)c1.N#C[B-](C#N)(C#N)C(F)(F)F |
| InChI | InChI=1S/C9H13N2O2.C4BF3N3/c1-3-9(12)13-7-6-11-5-4-10(2)8-11;6-4(7,8)5(1-9,2-10)3-11/h3-5,8H,1,6-7H2,2H3;/q+1;-1 |
| InChIKey | LCRAWNVHODWHFH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 106.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.09 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|