C14H16BF4IN2O — CID 139217860
1-[2-[1-(3-iodophenyl)ethenoxy]ethyl]-3-methylimidazol-3-ium tetrafluoroborate (PubChem CID 139217860) has the molecular formula C14H16BF4IN2O and a molecular weight of 442.00 g/mol. Its IUPAC name is 1-[2-[1-(3-iodophenyl)ethenoxy]ethyl]-3-methylimidazol-3-ium tetrafluoroborate.
| Compound Name | 1-[2-[1-(3-iodophenyl)ethenoxy]ethyl]-3-methylimidazol-3-ium tetrafluoroborate |
|---|---|
| PubChem CID | 139217860 |
| Molecular Formula | C14H16BF4IN2O |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 1-[2-[1-(3-iodophenyl)ethenoxy]ethyl]-3-methylimidazol-3-ium tetrafluoroborate |
| SMILES | C=C(OCCn1cc[n+](C)c1)c1cccc(I)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C14H16IN2O.BF4/c1-12(13-4-3-5-14(15)10-13)18-9-8-17-7-6-16(2)11-17;2-1(3,4)5/h3-7,10-11H,1,8-9H2,2H3;/q+1;-1 |
| InChIKey | QHFZGPYWHOIRGR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|